DIMESITYLBORON FLUORIDE
dimesitylboron fluoride
CAS: 436-59-9
Molecular Formula: C18H22BF
DIMESITYLBORON FLUORIDE - Names and Identifiers
| Name | dimesitylboron fluoride |
| Synonyms | DimesityL Dimesitylfluoroborane fluorodiMesitylborane DIMESITYLBORON FLUORIDE dimesitylboron fluoride fluorobis(2,4,6-trimethylphenyl)-borane Borane,fluorobis(2,4,6-triMethylphenyl)- |
| CAS | 436-59-9 |
| InChI | InChI=1/C18H22BF/c1-11-7-13(3)17(14(4)8-11)19(20)18-15(5)9-12(2)10-16(18)6/h7-10H,1-6H3 |
DIMESITYLBORON FLUORIDE - Physico-chemical Properties
| Molecular Formula | C18H22BF |
| Molar Mass | 268.18 |
| Density | 0.98±0.1 g/cm3(Predicted) |
| Melting Point | 69-72 °C (lit.) |
| Boling Point | 129°C/0.5mmHg(lit.) |
| Flash Point | 174.1°C |
| Solubility | soluble in Acetone,Ether |
| Vapor Presure | 3.59E-05mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Light yellow |
| Storage Condition | 2-8 ℃, stored in nitrogen |
| Refractive Index | 1.518 |
| MDL | MFCD00012203 |
DIMESITYLBORON FLUORIDE - Risk and Safety
| Hazard Symbols | C - Corrosive |
| Risk Codes | 34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S27 - Take off immediately all contaminated clothing. S28 - After contact with skin, wash immediately with plenty of soap-suds. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 29319090 |
| Hazard Class | 8 |
| Packing Group | III |
DIMESITYLBORON FLUORIDE - Introduction
dimesitylboron fluoride, often abbreviated as DMBF, is an organic compound. Its chemical formula is C21H21BF and its molecular weight is 310.12g/mol. The following is a description of the nature, use, preparation and safety information of DMBF:
Nature:
1. Appearance: DMBF is a colorless crystalline solid.
2. Melting point: about 77-80°C.
3. Solubility: DMBF is soluble in non-polar solvents, such as ether and benzene, but difficult to dissolve in water.
4. Stability: DMBF has good stability at room temperature, but it will decompose under high temperature and sunlight.
Use:
1. Reagent: DMBF is widely used as a reagent for organic synthesis reactions, especially in the synthesis of aromatic compounds.
2. Catalyst: DMBF can be used as an organic catalyst, such as a catalyst in C- N coupling reactions.
Preparation Method:
DMBF is usually synthesized by the following steps:
1. The reaction of trimethylphenyl boric acid and cuprous fluoride generates trimethylphenyl copper fluoroborate.
2. The above reaction product is treated with an acid to obtain DMBF therefrom.
Safety Information:
1. DMF is an organic compound, and care should be taken to avoid contact with skin and eyes.
2. Use protective gloves, goggles, and laboratory ventilation when using or handling DMF.
3. if inhaled or ingested DMBF by mistake, seek medical advice and provide relevant information in time.
4. When using and storing DMBF, please follow the chemical safety procedures and keep it away from fire and high temperature.
Nature:
1. Appearance: DMBF is a colorless crystalline solid.
2. Melting point: about 77-80°C.
3. Solubility: DMBF is soluble in non-polar solvents, such as ether and benzene, but difficult to dissolve in water.
4. Stability: DMBF has good stability at room temperature, but it will decompose under high temperature and sunlight.
Use:
1. Reagent: DMBF is widely used as a reagent for organic synthesis reactions, especially in the synthesis of aromatic compounds.
2. Catalyst: DMBF can be used as an organic catalyst, such as a catalyst in C- N coupling reactions.
Preparation Method:
DMBF is usually synthesized by the following steps:
1. The reaction of trimethylphenyl boric acid and cuprous fluoride generates trimethylphenyl copper fluoroborate.
2. The above reaction product is treated with an acid to obtain DMBF therefrom.
Safety Information:
1. DMF is an organic compound, and care should be taken to avoid contact with skin and eyes.
2. Use protective gloves, goggles, and laboratory ventilation when using or handling DMF.
3. if inhaled or ingested DMBF by mistake, seek medical advice and provide relevant information in time.
4. When using and storing DMBF, please follow the chemical safety procedures and keep it away from fire and high temperature.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: Dimesitylboron Fluoride Visit Supplier Webpage Request for quotation
CAS: 436-59-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 436-59-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Dimesitylboron Fluoride Visit Supplier Webpage Request for quotation
CAS: 436-59-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 436-59-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History